C12H10F8O6 — CID 122607501
4-[2,2,3,3,4,4,5,5-octafluoro-6-(2-oxo-1,3-dioxolan-4-yl)hexyl]-1,3-dioxolan-2-one (PubChem CID 122607501) has the molecular formula C12H10F8O6 and a molecular weight of 402.19 g/mol. Its IUPAC name is 4-[2,2,3,3,4,4,5,5-octafluoro-6-(2-oxo-1,3-dioxolan-4-yl)hexyl]-1,3-dioxolan-2-one.
| Compound Name | 4-[2,2,3,3,4,4,5,5-octafluoro-6-(2-oxo-1,3-dioxolan-4-yl)hexyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 122607501 |
| Molecular Formula | C12H10F8O6 |
| Molecular Weight | 402.19 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | 4-[2,2,3,3,4,4,5,5-octafluoro-6-(2-oxo-1,3-dioxolan-4-yl)hexyl]-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)CC2COC(=O)O2)O1 |
| InChI | InChI=1S/C12H10F8O6/c13-9(14,1-5-3-23-7(21)25-5)11(17,18)12(19,20)10(15,16)2-6-4-24-8(22)26-6/h5-6H,1-4H2 |
| InChIKey | SDQKIESDLUVISP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.19 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|