About (Z)-3-cyanoprop-2-enoyl iodide
(Z)-3-cyanoprop-2-enoyl iodide (PubChem CID 122607560) has the molecular formula C4H2INO
and a molecular weight of 206.97 g/mol. Its IUPAC name is (Z)-3-cyanoprop-2-enoyl iodide.
Molecular Properties
| Compound Name | (Z)-3-cyanoprop-2-enoyl iodide |
| PubChem CID | 122607560 |
| Molecular Formula | C4H2INO |
| Molecular Weight | 206.97 g/mol |
| Exact Mass | 206.92 |
| IUPAC Name | (Z)-3-cyanoprop-2-enoyl iodide |
| SMILES | N#C/C=C\C(=O)I |
| InChI | InChI=1S/C4H2INO/c5-4(7)2-1-3-6/h1-2H/b2-1- |
| InChIKey | XQQRJRXSMSXFNA-UPHRSURJSA-N |
| XLogP | 1.03 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.97 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-cyanoprop-2-enoyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-cyanoprop-2-enoyl iodide?
The IUPAC name of (Z)-3-cyanoprop-2-enoyl iodide (CID 122607560) is (Z)-3-cyanoprop-2-enoyl iodide.
What is the SMILES notation for (Z)-3-cyanoprop-2-enoyl iodide?
The canonical SMILES for (Z)-3-cyanoprop-2-enoyl iodide is N#C/C=C\C(=O)I.
What is the InChIKey of (Z)-3-cyanoprop-2-enoyl iodide?
The InChIKey is XQQRJRXSMSXFNA-UPHRSURJSA-N. The full InChI is InChI=1S/C4H2INO/c5-4(7)2-1-3-6/h1-2H/b2-1-.
What are the key properties of (Z)-3-cyanoprop-2-enoyl iodide?
(Z)-3-cyanoprop-2-enoyl iodide has a molecular weight of 206.97 g/mol, XLogP of 1.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-cyanoprop-2-enoyl iodide is sourced from PubChem (CID 122607560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).