C17H12N2 — CID 122607643
6-phenyl-9H-pyrido[3,4-b]indole (PubChem CID 122607643) has the molecular formula C17H12N2 and a molecular weight of 244.30 g/mol. Its IUPAC name is 6-phenyl-9H-pyrido[3,4-b]indole.
| Compound Name | 6-phenyl-9H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 122607643 |
| Molecular Formula | C17H12N2 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 6-phenyl-9H-pyrido[3,4-b]indole |
| SMILES | c1ccc(-c2ccc3[nH]c4cnccc4c3c2)cc1 |
| InChI | InChI=1S/C17H12N2/c1-2-4-12(5-3-1)13-6-7-16-15(10-13)14-8-9-18-11-17(14)19-16/h1-11,19H |
| InChIKey | WIPSJCIJFJGBPG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |