C46H50N2O4S2 — CID 122607713
3,6-bis[5-(1-benzofuran-2-yl)thiophen-2-yl]-2,5-bis(2-ethylhexyl)-1-hydroxy-1H-pyrrolo[3,4-c]pyrrol-4-one (PubChem CID 122607713) has the molecular formula C46H50N2O4S2 and a molecular weight of 759.05 g/mol. Its IUPAC name is 3,6-bis[5-(1-benzofuran-2-yl)thiophen-2-yl]-2,5-bis(2-ethylhexyl)-1-hydroxy-1H-pyrrolo[3,4-c]pyrrol-4-one.
| Compound Name | 3,6-bis[5-(1-benzofuran-2-yl)thiophen-2-yl]-2,5-bis(2-ethylhexyl)-1-hydroxy-1H-pyrrolo[3,4-c]pyrrol-4-one |
|---|---|
| PubChem CID | 122607713 |
| Molecular Formula | C46H50N2O4S2 |
| Molecular Weight | 759.05 g/mol |
| Exact Mass | 758.32 |
| IUPAC Name | 3,6-bis[5-(1-benzofuran-2-yl)thiophen-2-yl]-2,5-bis(2-ethylhexyl)-1-hydroxy-1H-pyrrolo[3,4-c]pyrrol-4-one |
| SMILES | CCCCC(CC)CN1C(=O)C2=C(c3ccc(-c4cc5ccccc5o4)s3)N(CC(CC)CCCC)C(O)C2=C1c1ccc(-c2cc3ccccc3o2)s1 |
| InChI | InChI=1S/C46H50N2O4S2/c1-5-9-15-29(7-3)27-47-43(39-23-21-37(53-39)35-25-31-17-11-13-19-33(31)51-35)41-42(45(47)49)44(48(46(41)50)28-30(8-4)16-10-6-2)40-24-22-38(54-40)36-26-32-18-12-14-20-34(32)52-36/h11-14,17-26,29-30,45,49H,5-10,15-16,27-28H2,1-4H3 |
| InChIKey | YEURGUSCTDWGRR-UHFFFAOYSA-N |
| XLogP | 12.67 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.05 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|