About propan-2-yl 5-(aminomethyl)-3-bromo-4-[2,3,4-tris(hydroxymethyl)phenyl]-1H-pyrrole-2-carboxylate
propan-2-yl 5-(aminomethyl)-3-bromo-4-[2,3,4-tris(hydroxymethyl)phenyl]-1H-pyrrole-2-carboxylate (PubChem CID 122607808) has the molecular formula C18H23BrN2O5
and a molecular weight of 427.30 g/mol. Its IUPAC name is propan-2-yl 5-(aminomethyl)-3-bromo-4-[2,3,4-tris(hydroxymethyl)phenyl]-1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 5-(aminomethyl)-3-bromo-4-[2,3,4-tris(hydroxymethyl)phenyl]-1H-pyrrole-2-carboxylate |
| PubChem CID | 122607808 |
| Molecular Formula | C18H23BrN2O5 |
| Molecular Weight | 427.30 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | propan-2-yl 5-(aminomethyl)-3-bromo-4-[2,3,4-tris(hydroxymethyl)phenyl]-1H-pyrrole-2-carboxylate |
| SMILES | CC(C)OC(=O)c1[nH]c(CN)c(-c2ccc(CO)c(CO)c2CO)c1Br |
| InChI | InChI=1S/C18H23BrN2O5/c1-9(2)26-18(25)17-16(19)15(14(5-20)21-17)11-4-3-10(6-22)12(7-23)13(11)8-24/h3-4,9,21-24H,5-8,20H2,1-2H3 |
| InChIKey | OKLCVKTZYIYQNE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze propan-2-yl 5-(aminomethyl)-3-bromo-4-[2,3,4-tris(hydroxymethyl)phenyl]-1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 5-(aminomethyl)-3-bromo-4-[2,3,4-tris(hydroxymethyl)phenyl]-1H-pyrrole-2-carboxylate?
The IUPAC name of propan-2-yl 5-(aminomethyl)-3-bromo-4-[2,3,4-tris(hydroxymethyl)phenyl]-1H-pyrrole-2-carboxylate (CID 122607808) is propan-2-yl 5-(aminomethyl)-3-bromo-4-[2,3,4-tris(hydroxymethyl)phenyl]-1H-pyrrole-2-carboxylate.
What is the SMILES notation for propan-2-yl 5-(aminomethyl)-3-bromo-4-[2,3,4-tris(hydroxymethyl)phenyl]-1H-pyrrole-2-carboxylate?
The canonical SMILES for propan-2-yl 5-(aminomethyl)-3-bromo-4-[2,3,4-tris(hydroxymethyl)phenyl]-1H-pyrrole-2-carboxylate is CC(C)OC(=O)c1[nH]c(CN)c(-c2ccc(CO)c(CO)c2CO)c1Br.
What is the InChIKey of propan-2-yl 5-(aminomethyl)-3-bromo-4-[2,3,4-tris(hydroxymethyl)phenyl]-1H-pyrrole-2-carboxylate?
The InChIKey is OKLCVKTZYIYQNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23BrN2O5/c1-9(2)26-18(25)17-16(19)15(14(5-20)21-17)11-4-3-10(6-22)12(7-23)13(11)8-24/h3-4,9,21-24H,5-8,20H2,1-2H3.
What are the key properties of propan-2-yl 5-(aminomethyl)-3-bromo-4-[2,3,4-tris(hydroxymethyl)phenyl]-1H-pyrrole-2-carboxylate?
propan-2-yl 5-(aminomethyl)-3-bromo-4-[2,3,4-tris(hydroxymethyl)phenyl]-1H-pyrrole-2-carboxylate has a molecular weight of 427.30 g/mol, XLogP of 1.95, 7 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 5-(aminomethyl)-3-bromo-4-[2,3,4-tris(hydroxymethyl)phenyl]-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 122607808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).