C27H26F3N5O4 — CID 122608776
tert-butyl 2-(2-methoxy-4-pyridinyl)-7-[4-(2,2,2-trifluoroethyl)-2,3-dihydro-1,4-benzoxazin-6-yl]pyrrolo[2,3-b]pyrazine-5-carboxylate (PubChem CID 122608776) has the molecular formula C27H26F3N5O4 and a molecular weight of 541.53 g/mol. Its IUPAC name is tert-butyl 2-(2-methoxy-4-pyridinyl)-7-[4-(2,2,2-trifluoroethyl)-2,3-dihydro-1,4-benzoxazin-6-yl]pyrrolo[2,3-b]pyrazine-5-carboxylate.
| Compound Name | tert-butyl 2-(2-methoxy-4-pyridinyl)-7-[4-(2,2,2-trifluoroethyl)-2,3-dihydro-1,4-benzoxazin-6-yl]pyrrolo[2,3-b]pyrazine-5-carboxylate |
|---|---|
| PubChem CID | 122608776 |
| Molecular Formula | C27H26F3N5O4 |
| Molecular Weight | 541.53 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | tert-butyl 2-(2-methoxy-4-pyridinyl)-7-[4-(2,2,2-trifluoroethyl)-2,3-dihydro-1,4-benzoxazin-6-yl]pyrrolo[2,3-b]pyrazine-5-carboxylate |
| SMILES | COc1cc(-c2cnc3c(n2)c(-c2ccc4c(c2)N(CC(F)(F)F)CCO4)cn3C(=O)OC(C)(C)C)ccn1 |
| InChI | InChI=1S/C27H26F3N5O4/c1-26(2,3)39-25(36)35-14-18(16-5-6-21-20(11-16)34(9-10-38-21)15-27(28,29)30)23-24(35)32-13-19(33-23)17-7-8-31-22(12-17)37-4/h5-8,11-14H,9-10,15H2,1-4H3 |
| InChIKey | COQJTEDOGSGZTF-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 91.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |