About cyclohexyl-(7,8-dichloroimidazo[1,5-a]pyridin-5-yl)methanol
cyclohexyl-(7,8-dichloroimidazo[1,5-a]pyridin-5-yl)methanol (PubChem CID 122609366) has the molecular formula C14H16Cl2N2O
and a molecular weight of 299.20 g/mol. Its IUPAC name is cyclohexyl-(7,8-dichloroimidazo[1,5-a]pyridin-5-yl)methanol.
Molecular Properties
| Compound Name | cyclohexyl-(7,8-dichloroimidazo[1,5-a]pyridin-5-yl)methanol |
| PubChem CID | 122609366 |
| Molecular Formula | C14H16Cl2N2O |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | cyclohexyl-(7,8-dichloroimidazo[1,5-a]pyridin-5-yl)methanol |
| SMILES | OC(c1cc(Cl)c(Cl)c2cncn12)C1CCCCC1 |
| InChI | InChI=1S/C14H16Cl2N2O/c15-10-6-11(14(19)9-4-2-1-3-5-9)18-8-17-7-12(18)13(10)16/h6-9,14,19H,1-5H2 |
| InChIKey | LKJPXULERNECRH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexyl-(7,8-dichloroimidazo[1,5-a]pyridin-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-(7,8-dichloroimidazo[1,5-a]pyridin-5-yl)methanol?
The IUPAC name of cyclohexyl-(7,8-dichloroimidazo[1,5-a]pyridin-5-yl)methanol (CID 122609366) is cyclohexyl-(7,8-dichloroimidazo[1,5-a]pyridin-5-yl)methanol.
What is the SMILES notation for cyclohexyl-(7,8-dichloroimidazo[1,5-a]pyridin-5-yl)methanol?
The canonical SMILES for cyclohexyl-(7,8-dichloroimidazo[1,5-a]pyridin-5-yl)methanol is OC(c1cc(Cl)c(Cl)c2cncn12)C1CCCCC1.
What is the InChIKey of cyclohexyl-(7,8-dichloroimidazo[1,5-a]pyridin-5-yl)methanol?
The InChIKey is LKJPXULERNECRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16Cl2N2O/c15-10-6-11(14(19)9-4-2-1-3-5-9)18-8-17-7-12(18)13(10)16/h6-9,14,19H,1-5H2.
What are the key properties of cyclohexyl-(7,8-dichloroimidazo[1,5-a]pyridin-5-yl)methanol?
cyclohexyl-(7,8-dichloroimidazo[1,5-a]pyridin-5-yl)methanol has a molecular weight of 299.20 g/mol, XLogP of 4.25, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-(7,8-dichloroimidazo[1,5-a]pyridin-5-yl)methanol is sourced from PubChem (CID 122609366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).