C33H37N3O5 — CID 122609699
N-cyclohexyl-2-(N-[2-(1H-indol-3-yl)acetyl]anilino)-2-(2,3,4-trimethoxyphenyl)acetamide (PubChem CID 122609699) has the molecular formula C33H37N3O5 and a molecular weight of 555.68 g/mol. Its IUPAC name is N-cyclohexyl-2-(N-[2-(1H-indol-3-yl)acetyl]anilino)-2-(2,3,4-trimethoxyphenyl)acetamide.
| Compound Name | N-cyclohexyl-2-(N-[2-(1H-indol-3-yl)acetyl]anilino)-2-(2,3,4-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 122609699 |
| Molecular Formula | C33H37N3O5 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | N-cyclohexyl-2-(N-[2-(1H-indol-3-yl)acetyl]anilino)-2-(2,3,4-trimethoxyphenyl)acetamide |
| SMILES | COc1ccc(C(C(=O)NC2CCCCC2)N(C(=O)Cc2c[nH]c3ccccc23)c2ccccc2)c(OC)c1OC |
| InChI | InChI=1S/C33H37N3O5/c1-39-28-19-18-26(31(40-2)32(28)41-3)30(33(38)35-23-12-6-4-7-13-23)36(24-14-8-5-9-15-24)29(37)20-22-21-34-27-17-11-10-16-25(22)27/h5,8-11,14-19,21,23,30,34H,4,6-7,12-13,20H2,1-3H3,(H,35,38) |
| InChIKey | GRRRVKYCBSIYQY-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |