C11H7F11O6 — CID 122609747
(2-oxo-1,3-dioxolan-4-yl)methyl 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl carbonate (PubChem CID 122609747) has the molecular formula C11H7F11O6 and a molecular weight of 444.15 g/mol. Its IUPAC name is (2-oxo-1,3-dioxolan-4-yl)methyl 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl carbonate.
| Compound Name | (2-oxo-1,3-dioxolan-4-yl)methyl 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl carbonate |
|---|---|
| PubChem CID | 122609747 |
| Molecular Formula | C11H7F11O6 |
| Molecular Weight | 444.15 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | (2-oxo-1,3-dioxolan-4-yl)methyl 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl carbonate |
| SMILES | O=C(OCC1COC(=O)O1)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H7F11O6/c12-7(13,3-27-5(23)25-1-4-2-26-6(24)28-4)8(14,15)9(16,17)10(18,19)11(20,21)22/h4H,1-3H2 |
| InChIKey | BETNJUKXKWTSIV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.15 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|