C54H36F4N4O3 — CID 122609757
4,7-bis(10-tert-butyl-[1]benzofuro[2,3-b]carbazol-7-yl)-1,1,3,3-tetrafluoro-2-benzofuran-5,6-dicarbonitrile (PubChem CID 122609757) has the molecular formula C54H36F4N4O3 and a molecular weight of 864.90 g/mol. Its IUPAC name is 4,7-bis(10-tert-butyl-[1]benzofuro[2,3-b]carbazol-7-yl)-1,1,3,3-tetrafluoro-2-benzofuran-5,6-dicarbonitrile.
| Compound Name | 4,7-bis(10-tert-butyl-[1]benzofuro[2,3-b]carbazol-7-yl)-1,1,3,3-tetrafluoro-2-benzofuran-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 122609757 |
| Molecular Formula | C54H36F4N4O3 |
| Molecular Weight | 864.90 g/mol |
| Exact Mass | 864.27 |
| IUPAC Name | 4,7-bis(10-tert-butyl-[1]benzofuro[2,3-b]carbazol-7-yl)-1,1,3,3-tetrafluoro-2-benzofuran-5,6-dicarbonitrile |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc3c(cc1n2-c1c(C#N)c(C#N)c(-n2c4ccc(C(C)(C)C)cc4c4cc5c(cc42)oc2ccccc25)c2c1C(F)(F)OC2(F)F)oc1ccccc13 |
| InChI | InChI=1S/C54H36F4N4O3/c1-51(2,3)27-15-17-39-31(19-27)33-21-35-29-11-7-9-13-43(29)63-45(35)23-41(33)61(39)49-37(25-59)38(26-60)50(48-47(49)53(55,56)65-54(48,57)58)62-40-18-16-28(52(4,5)6)20-32(40)34-22-36-30-12-8-10-14-44(30)64-46(36)24-42(34)62/h7-24H,1-6H3 |
| InChIKey | FGYFAVNKEHFOGM-UHFFFAOYSA-N |
| XLogP | 15.15 |
| TPSA | 92.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.90 |
| LogP ≤ 5 | 15.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |