C46H26F4N6 — CID 122609855
5,5,8,8-tetrafluoro-1,4-bis(8-phenylpyrido[4,3-b]indol-5-yl)-6,7-dihydronaphthalene-2,3-dicarbonitrile (PubChem CID 122609855) has the molecular formula C46H26F4N6 and a molecular weight of 738.75 g/mol. Its IUPAC name is 5,5,8,8-tetrafluoro-1,4-bis(8-phenylpyrido[4,3-b]indol-5-yl)-6,7-dihydronaphthalene-2,3-dicarbonitrile.
| Compound Name | 5,5,8,8-tetrafluoro-1,4-bis(8-phenylpyrido[4,3-b]indol-5-yl)-6,7-dihydronaphthalene-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 122609855 |
| Molecular Formula | C46H26F4N6 |
| Molecular Weight | 738.75 g/mol |
| Exact Mass | 738.22 |
| IUPAC Name | 5,5,8,8-tetrafluoro-1,4-bis(8-phenylpyrido[4,3-b]indol-5-yl)-6,7-dihydronaphthalene-2,3-dicarbonitrile |
| SMILES | N#Cc1c(C#N)c(-n2c3ccncc3c3cc(-c4ccccc4)ccc32)c2c(c1-n1c3ccncc3c3cc(-c4ccccc4)ccc31)C(F)(F)CCC2(F)F |
| InChI | InChI=1S/C46H26F4N6/c47-45(48)17-18-46(49,50)42-41(45)43(55-37-13-11-29(27-7-3-1-4-8-27)21-31(37)35-25-53-19-15-39(35)55)33(23-51)34(24-52)44(42)56-38-14-12-30(28-9-5-2-6-10-28)22-32(38)36-26-54-20-16-40(36)56/h1-16,19-22,25-26H,17-18H2 |
| InChIKey | ZCGQDJYAUVANDW-UHFFFAOYSA-N |
| XLogP | 11.73 |
| TPSA | 83.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.75 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |