C65H46N4O2 — CID 122609866
4,7-bis(12,12-dimethyl-8-phenylindeno[2,1-a]carbazol-11-yl)-2,2-dimethyl-1,3-benzodioxole-5,6-dicarbonitrile (PubChem CID 122609866) has the molecular formula C65H46N4O2 and a molecular weight of 915.11 g/mol. Its IUPAC name is 4,7-bis(12,12-dimethyl-8-phenylindeno[2,1-a]carbazol-11-yl)-2,2-dimethyl-1,3-benzodioxole-5,6-dicarbonitrile.
| Compound Name | 4,7-bis(12,12-dimethyl-8-phenylindeno[2,1-a]carbazol-11-yl)-2,2-dimethyl-1,3-benzodioxole-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 122609866 |
| Molecular Formula | C65H46N4O2 |
| Molecular Weight | 915.11 g/mol |
| Exact Mass | 914.36 |
| IUPAC Name | 4,7-bis(12,12-dimethyl-8-phenylindeno[2,1-a]carbazol-11-yl)-2,2-dimethyl-1,3-benzodioxole-5,6-dicarbonitrile |
| SMILES | CC1(C)Oc2c(c(-n3c4ccc(-c5ccccc5)cc4c4ccc5c(c43)C(C)(C)c3ccccc3-5)c(C#N)c(C#N)c2-n2c3ccc(-c4ccccc4)cc3c3ccc4c(c32)C(C)(C)c2ccccc2-4)O1 |
| InChI | InChI=1S/C65H46N4O2/c1-63(2)51-23-15-13-21-41(51)43-27-29-45-47-33-39(37-17-9-7-10-18-37)25-31-53(47)68(57(45)55(43)63)59-49(35-66)50(36-67)60(62-61(59)70-65(5,6)71-62)69-54-32-26-40(38-19-11-8-12-20-38)34-48(54)46-30-28-44-42-22-14-16-24-52(42)64(3,4)56(44)58(46)69/h7-34H,1-6H3 |
| InChIKey | ADRCHEZEFFHNCL-UHFFFAOYSA-N |
| XLogP | 16.08 |
| TPSA | 75.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.11 |
| LogP ≤ 5 | 16.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |