C9H5F11O3 — CID 122609882
4-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl)-1,3-dioxolan-2-one (PubChem CID 122609882) has the molecular formula C9H5F11O3 and a molecular weight of 370.11 g/mol. Its IUPAC name is 4-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl)-1,3-dioxolan-2-one.
| Compound Name | 4-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 122609882 |
| Molecular Formula | C9H5F11O3 |
| Molecular Weight | 370.11 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | 4-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl)-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C9H5F11O3/c10-5(11,1-3-2-22-4(21)23-3)6(12,13)7(14,15)8(16,17)9(18,19)20/h3H,1-2H2 |
| InChIKey | MFORPSFHHLEZAY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.11 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|