About (Z,3E)-N'-methyl-3-prop-2-enylidene-N'-propylbut-1-ene-1,4-diamine
(Z,3E)-N'-methyl-3-prop-2-enylidene-N'-propylbut-1-ene-1,4-diamine (PubChem CID 122609910) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is (Z,3E)-N'-methyl-3-prop-2-enylidene-N'-propylbut-1-ene-1,4-diamine.
Molecular Properties
| Compound Name | (Z,3E)-N'-methyl-3-prop-2-enylidene-N'-propylbut-1-ene-1,4-diamine |
| PubChem CID | 122609910 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (Z,3E)-N'-methyl-3-prop-2-enylidene-N'-propylbut-1-ene-1,4-diamine |
| SMILES | C=C/C=C(\C=C/N)CN(C)CCC |
| InChI | InChI=1S/C11H20N2/c1-4-6-11(7-8-12)10-13(3)9-5-2/h4,6-8H,1,5,9-10,12H2,2-3H3/b8-7-,11-6+ |
| InChIKey | XIIRALSNUJWAOM-YKFSIMETSA-N |
| XLogP | 1.91 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z,3E)-N'-methyl-3-prop-2-enylidene-N'-propylbut-1-ene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,3E)-N'-methyl-3-prop-2-enylidene-N'-propylbut-1-ene-1,4-diamine?
The IUPAC name of (Z,3E)-N'-methyl-3-prop-2-enylidene-N'-propylbut-1-ene-1,4-diamine (CID 122609910) is (Z,3E)-N'-methyl-3-prop-2-enylidene-N'-propylbut-1-ene-1,4-diamine.
What is the SMILES notation for (Z,3E)-N'-methyl-3-prop-2-enylidene-N'-propylbut-1-ene-1,4-diamine?
The canonical SMILES for (Z,3E)-N'-methyl-3-prop-2-enylidene-N'-propylbut-1-ene-1,4-diamine is C=C/C=C(\C=C/N)CN(C)CCC.
What is the InChIKey of (Z,3E)-N'-methyl-3-prop-2-enylidene-N'-propylbut-1-ene-1,4-diamine?
The InChIKey is XIIRALSNUJWAOM-YKFSIMETSA-N. The full InChI is InChI=1S/C11H20N2/c1-4-6-11(7-8-12)10-13(3)9-5-2/h4,6-8H,1,5,9-10,12H2,2-3H3/b8-7-,11-6+.
What are the key properties of (Z,3E)-N'-methyl-3-prop-2-enylidene-N'-propylbut-1-ene-1,4-diamine?
(Z,3E)-N'-methyl-3-prop-2-enylidene-N'-propylbut-1-ene-1,4-diamine has a molecular weight of 180.29 g/mol, XLogP of 1.91, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,3E)-N'-methyl-3-prop-2-enylidene-N'-propylbut-1-ene-1,4-diamine is sourced from PubChem (CID 122609910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).