C65H48N6 — CID 122609988
1,1,2,2,3,3-hexamethyl-4,7-bis(11-phenylindolo[2,3-a]carbazol-12-yl)indene-5,6-dicarbonitrile (PubChem CID 122609988) has the molecular formula C65H48N6 and a molecular weight of 913.14 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexamethyl-4,7-bis(11-phenylindolo[2,3-a]carbazol-12-yl)indene-5,6-dicarbonitrile.
| Compound Name | 1,1,2,2,3,3-hexamethyl-4,7-bis(11-phenylindolo[2,3-a]carbazol-12-yl)indene-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 122609988 |
| Molecular Formula | C65H48N6 |
| Molecular Weight | 913.14 g/mol |
| Exact Mass | 912.39 |
| IUPAC Name | 1,1,2,2,3,3-hexamethyl-4,7-bis(11-phenylindolo[2,3-a]carbazol-12-yl)indene-5,6-dicarbonitrile |
| SMILES | CC1(C)c2c(-n3c4ccccc4c4ccc5c6ccccc6n(-c6ccccc6)c5c43)c(C#N)c(C#N)c(-n3c4ccccc4c4ccc5c6ccccc6n(-c6ccccc6)c5c43)c2C(C)(C)C1(C)C |
| InChI | InChI=1S/C65H48N6/c1-63(2)55-56(64(3,4)65(63,5)6)58(71-54-32-20-16-28-44(54)48-36-34-46-42-26-14-18-30-52(42)69(60(46)62(48)71)40-23-11-8-12-24-40)50(38-67)49(37-66)57(55)70-53-31-19-15-27-43(53)47-35-33-45-41-25-13-17-29-51(41)68(59(45)61(47)70)39-21-9-7-10-22-39/h7-36H,1-6H3 |
| InChIKey | QJGVPASMPXNHGP-UHFFFAOYSA-N |
| XLogP | 16.41 |
| TPSA | 67.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.14 |
| LogP ≤ 5 | 16.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |