About acetic acid;N,2-dimethyl-N-[2-(methylamino)ethyl]prop-2-enamide
acetic acid;N,2-dimethyl-N-[2-(methylamino)ethyl]prop-2-enamide (PubChem CID 122611801) has the molecular formula C10H20N2O3
and a molecular weight of 216.28 g/mol. Its IUPAC name is acetic acid;N,2-dimethyl-N-[2-(methylamino)ethyl]prop-2-enamide.
Molecular Properties
| Compound Name | acetic acid;N,2-dimethyl-N-[2-(methylamino)ethyl]prop-2-enamide |
| PubChem CID | 122611801 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | acetic acid;N,2-dimethyl-N-[2-(methylamino)ethyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)N(C)CCNC.CC(=O)O |
| InChI | InChI=1S/C8H16N2O.C2H4O2/c1-7(2)8(11)10(4)6-5-9-3;1-2(3)4/h9H,1,5-6H2,2-4H3;1H3,(H,3,4) |
| InChIKey | SXTRRHHEKVYAGK-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;N,2-dimethyl-N-[2-(methylamino)ethyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;N,2-dimethyl-N-[2-(methylamino)ethyl]prop-2-enamide?
The IUPAC name of acetic acid;N,2-dimethyl-N-[2-(methylamino)ethyl]prop-2-enamide (CID 122611801) is acetic acid;N,2-dimethyl-N-[2-(methylamino)ethyl]prop-2-enamide.
What is the SMILES notation for acetic acid;N,2-dimethyl-N-[2-(methylamino)ethyl]prop-2-enamide?
The canonical SMILES for acetic acid;N,2-dimethyl-N-[2-(methylamino)ethyl]prop-2-enamide is C=C(C)C(=O)N(C)CCNC.CC(=O)O.
What is the InChIKey of acetic acid;N,2-dimethyl-N-[2-(methylamino)ethyl]prop-2-enamide?
The InChIKey is SXTRRHHEKVYAGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O.C2H4O2/c1-7(2)8(11)10(4)6-5-9-3;1-2(3)4/h9H,1,5-6H2,2-4H3;1H3,(H,3,4).
What are the key properties of acetic acid;N,2-dimethyl-N-[2-(methylamino)ethyl]prop-2-enamide?
acetic acid;N,2-dimethyl-N-[2-(methylamino)ethyl]prop-2-enamide has a molecular weight of 216.28 g/mol, XLogP of 0.33, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;N,2-dimethyl-N-[2-(methylamino)ethyl]prop-2-enamide is sourced from PubChem (CID 122611801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).