About azane;ethenyl anthracene-1-sulfonate
azane;ethenyl anthracene-1-sulfonate (PubChem CID 122612173) has the molecular formula C16H15NO3S
and a molecular weight of 301.37 g/mol. Its IUPAC name is azane;ethenyl anthracene-1-sulfonate.
Molecular Properties
| Compound Name | azane;ethenyl anthracene-1-sulfonate |
| PubChem CID | 122612173 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | azane;ethenyl anthracene-1-sulfonate |
| SMILES | C=COS(=O)(=O)c1cccc2cc3ccccc3cc12.N |
| InChI | InChI=1S/C16H12O3S.H3N/c1-2-19-20(17,18)16-9-5-8-14-10-12-6-3-4-7-13(12)11-15(14)16;/h2-11H,1H2;1H3 |
| InChIKey | CNKXQIRXYZUKKD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze azane;ethenyl anthracene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;ethenyl anthracene-1-sulfonate?
The IUPAC name of azane;ethenyl anthracene-1-sulfonate (CID 122612173) is azane;ethenyl anthracene-1-sulfonate.
What is the SMILES notation for azane;ethenyl anthracene-1-sulfonate?
The canonical SMILES for azane;ethenyl anthracene-1-sulfonate is C=COS(=O)(=O)c1cccc2cc3ccccc3cc12.N.
What is the InChIKey of azane;ethenyl anthracene-1-sulfonate?
The InChIKey is CNKXQIRXYZUKKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O3S.H3N/c1-2-19-20(17,18)16-9-5-8-14-10-12-6-3-4-7-13(12)11-15(14)16;/h2-11H,1H2;1H3.
What are the key properties of azane;ethenyl anthracene-1-sulfonate?
azane;ethenyl anthracene-1-sulfonate has a molecular weight of 301.37 g/mol, XLogP of 4.00, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;ethenyl anthracene-1-sulfonate is sourced from PubChem (CID 122612173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).