C12H7Cl2F5O2 — CID 122615521
2,2-dichloro-3-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]cyclopropane-1-carboxylic acid (PubChem CID 122615521) has the molecular formula C12H7Cl2F5O2 and a molecular weight of 349.08 g/mol. Its IUPAC name is 2,2-dichloro-3-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2,2-dichloro-3-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 122615521 |
| Molecular Formula | C12H7Cl2F5O2 |
| Molecular Weight | 349.08 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | 2,2-dichloro-3-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1C(c2ccc(C(F)(F)C(F)(F)F)cc2)C1(Cl)Cl |
| InChI | InChI=1S/C12H7Cl2F5O2/c13-10(14)7(8(10)9(20)21)5-1-3-6(4-2-5)11(15,16)12(17,18)19/h1-4,7-8H,(H,20,21) |
| InChIKey | FHOJVSGQXBCASL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.08 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|