C18H12Cl2F6O — CID 122615774
1-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]-3,5-bis(trifluoromethyl)benzene (PubChem CID 122615774) has the molecular formula C18H12Cl2F6O and a molecular weight of 429.19 g/mol. Its IUPAC name is 1-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 122615774 |
| Molecular Formula | C18H12Cl2F6O |
| Molecular Weight | 429.19 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 1-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]-3,5-bis(trifluoromethyl)benzene |
| SMILES | COc1ccc([C@H]2[C@H](c3cc(C(F)(F)F)cc(C(F)(F)F)c3)C2(Cl)Cl)cc1 |
| InChI | InChI=1S/C18H12Cl2F6O/c1-27-13-4-2-9(3-5-13)14-15(16(14,19)20)10-6-11(17(21,22)23)8-12(7-10)18(24,25)26/h2-8,14-15H,1H3/t14-,15-/m0/s1 |
| InChIKey | OCDIOOYWNVCKGN-GJZGRUSLSA-N |
| XLogP | 6.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.19 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|