C17H12BrFN2O3 — CID 122615890
2-[(6-bromo-8-fluoro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methyl]isoindole-1,3-dione (PubChem CID 122615890) has the molecular formula C17H12BrFN2O3 and a molecular weight of 391.20 g/mol. Its IUPAC name is 2-[(6-bromo-8-fluoro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(6-bromo-8-fluoro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 122615890 |
| Molecular Formula | C17H12BrFN2O3 |
| Molecular Weight | 391.20 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | 2-[(6-bromo-8-fluoro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC1CNc2cc(Br)cc(F)c2O1 |
| InChI | InChI=1S/C17H12BrFN2O3/c18-9-5-13(19)15-14(6-9)20-7-10(24-15)8-21-16(22)11-3-1-2-4-12(11)17(21)23/h1-6,10,20H,7-8H2 |
| InChIKey | FMMITVUIEYQNHW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.20 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|