C23H30F3N5O8S2 — CID 122616211
(1,1,1-trifluoro-2-methylpropan-2-yl) N-[2-[(cyclopropylsulfonylamino)methyl]-4-(1-ethyl-3-methoxypyrazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate (PubChem CID 122616211) has the molecular formula C23H30F3N5O8S2 and a molecular weight of 625.65 g/mol. Its IUPAC name is (1,1,1-trifluoro-2-methylpropan-2-yl) N-[2-[(cyclopropylsulfonylamino)methyl]-4-(1-ethyl-3-methoxypyrazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate.
| Compound Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[2-[(cyclopropylsulfonylamino)methyl]-4-(1-ethyl-3-methoxypyrazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
|---|---|
| PubChem CID | 122616211 |
| Molecular Formula | C23H30F3N5O8S2 |
| Molecular Weight | 625.65 g/mol |
| Exact Mass | 625.15 |
| IUPAC Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[2-[(cyclopropylsulfonylamino)methyl]-4-(1-ethyl-3-methoxypyrazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
| SMILES | CCn1cc(S(=O)(=O)N2CC(CNS(=O)(=O)C3CC3)Oc3ccc(NC(=O)OC(C)(C)C(F)(F)F)cc32)c(OC)n1 |
| InChI | InChI=1S/C23H30F3N5O8S2/c1-5-30-13-19(20(29-30)37-4)41(35,36)31-12-15(11-27-40(33,34)16-7-8-16)38-18-9-6-14(10-17(18)31)28-21(32)39-22(2,3)23(24,25)26/h6,9-10,13,15-16,27H,5,7-8,11-12H2,1-4H3,(H,28,32) |
| InChIKey | JTYWSVJXUOZGBA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 158.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.65 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |