About (3-methylimidazol-3-ium-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone
(3-methylimidazol-3-ium-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone (PubChem CID 122616488) has the molecular formula C17H20N3O2+
and a molecular weight of 298.37 g/mol. Its IUPAC name is (3-methylimidazol-3-ium-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone.
Molecular Properties
| Compound Name | (3-methylimidazol-3-ium-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone |
| PubChem CID | 122616488 |
| Molecular Formula | C17H20N3O2+ |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (3-methylimidazol-3-ium-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone |
| SMILES | C[n+]1ccn(C(=O)N2CC3(CCOCC3)c3ccccc32)c1 |
| InChI | InChI=1S/C17H20N3O2/c1-18-8-9-19(13-18)16(21)20-12-17(6-10-22-11-7-17)14-4-2-3-5-15(14)20/h2-5,8-9,13H,6-7,10-12H2,1H3/q+1 |
| InChIKey | MVTKMMUNOKHAGO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 38.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (3-methylimidazol-3-ium-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylimidazol-3-ium-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone?
The IUPAC name of (3-methylimidazol-3-ium-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone (CID 122616488) is (3-methylimidazol-3-ium-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone.
What is the SMILES notation for (3-methylimidazol-3-ium-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone?
The canonical SMILES for (3-methylimidazol-3-ium-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone is C[n+]1ccn(C(=O)N2CC3(CCOCC3)c3ccccc32)c1.
What is the InChIKey of (3-methylimidazol-3-ium-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone?
The InChIKey is MVTKMMUNOKHAGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N3O2/c1-18-8-9-19(13-18)16(21)20-12-17(6-10-22-11-7-17)14-4-2-3-5-15(14)20/h2-5,8-9,13H,6-7,10-12H2,1H3/q+1.
What are the key properties of (3-methylimidazol-3-ium-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone?
(3-methylimidazol-3-ium-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone has a molecular weight of 298.37 g/mol, XLogP of 1.85, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylimidazol-3-ium-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone is sourced from PubChem (CID 122616488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).