C10H11F3N6 — CID 122616722
1-methyl-6-(3,3,3-trifluoropropyl)pyrazolo[3,4-d]pyrimidine-4-carboximidamide (PubChem CID 122616722) has the molecular formula C10H11F3N6 and a molecular weight of 272.23 g/mol. Its IUPAC name is 1-methyl-6-(3,3,3-trifluoropropyl)pyrazolo[3,4-d]pyrimidine-4-carboximidamide.
| Compound Name | 1-methyl-6-(3,3,3-trifluoropropyl)pyrazolo[3,4-d]pyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 122616722 |
| Molecular Formula | C10H11F3N6 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1-methyl-6-(3,3,3-trifluoropropyl)pyrazolo[3,4-d]pyrimidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1nc(CCC(F)(F)F)nc2c1cnn2C |
| InChI | InChI=1S/C10H11F3N6/c1-19-9-5(4-16-19)7(8(14)15)17-6(18-9)2-3-10(11,12)13/h4H,2-3H2,1H3,(H3,14,15) |
| InChIKey | FIEYEUJSPBTTJX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|