C22H18F5N9O — CID 122616794
4-amino-5-methyl-2-[5-(3,3,4,4,4-pentafluorobutyl)-3-(trideuteriomethyl)triazolo[4,5-d]pyrimidin-7-yl]-5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 122616794) has the molecular formula C22H18F5N9O and a molecular weight of 522.46 g/mol. Its IUPAC name is 4-amino-5-methyl-2-[5-(3,3,4,4,4-pentafluorobutyl)-3-(trideuteriomethyl)triazolo[4,5-d]pyrimidin-7-yl]-5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-5-methyl-2-[5-(3,3,4,4,4-pentafluorobutyl)-3-(trideuteriomethyl)triazolo[4,5-d]pyrimidin-7-yl]-5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 122616794 |
| Molecular Formula | C22H18F5N9O |
| Molecular Weight | 522.46 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 4-amino-5-methyl-2-[5-(3,3,4,4,4-pentafluorobutyl)-3-(trideuteriomethyl)triazolo[4,5-d]pyrimidin-7-yl]-5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | [2H]C([2H])([2H])n1nnc2c(-c3nc(N)c4c(n3)NC(=O)C4(C)c3ccccc3)nc(CCC(F)(F)C(F)(F)F)nc21 |
| InChI | InChI=1S/C22H18F5N9O/c1-20(10-6-4-3-5-7-10)12-15(28)31-17(32-16(12)33-19(20)37)13-14-18(36(2)35-34-14)30-11(29-13)8-9-21(23,24)22(25,26)27/h3-7H,8-9H2,1-2H3,(H3,28,31,32,33,37)/i2D3 |
| InChIKey | HGYLDQBQFAIOQH-BMSJAHLVSA-N |
| XLogP | 3.19 |
| TPSA | 137.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|