C11H6BrCl2F3O2 — CID 122618546
trans-(1S,3S)-3-[3-bromo-5-(trifluoromethyl)phenyl]-2,2-dichlorocyclopropane-1-carboxylic acid (PubChem CID 122618546) has the molecular formula C11H6BrCl2F3O2 and a molecular weight of 377.97 g/mol. Its IUPAC name is trans-(1S,3S)-3-[3-bromo-5-(trifluoromethyl)phenyl]-2,2-dichlorocyclopropane-1-carboxylic acid.
| Compound Name | trans-(1S,3S)-3-[3-bromo-5-(trifluoromethyl)phenyl]-2,2-dichlorocyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 122618546 |
| Molecular Formula | C11H6BrCl2F3O2 |
| Molecular Weight | 377.97 g/mol |
| Exact Mass | 375.89 |
| IUPAC Name | trans-(1S,3S)-3-[3-bromo-5-(trifluoromethyl)phenyl]-2,2-dichlorocyclopropane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@@H](c2cc(Br)cc(C(F)(F)F)c2)C1(Cl)Cl |
| InChI | InChI=1S/C11H6BrCl2F3O2/c12-6-2-4(1-5(3-6)11(15,16)17)7-8(9(18)19)10(7,13)14/h1-3,7-8H,(H,18,19)/t7-,8+/m1/s1 |
| InChIKey | GOIDVRAXQFUOKQ-SFYZADRCSA-N |
| XLogP | 4.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.97 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|