C23H23N5O2 — CID 122620864
1-benzyl-2-methyl-6-(2-morpholin-4-ylpyrimidin-5-yl)indazol-3-one (PubChem CID 122620864) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 1-benzyl-2-methyl-6-(2-morpholin-4-ylpyrimidin-5-yl)indazol-3-one.
| Compound Name | 1-benzyl-2-methyl-6-(2-morpholin-4-ylpyrimidin-5-yl)indazol-3-one |
|---|---|
| PubChem CID | 122620864 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 1-benzyl-2-methyl-6-(2-morpholin-4-ylpyrimidin-5-yl)indazol-3-one |
| SMILES | Cn1c(=O)c2ccc(-c3cnc(N4CCOCC4)nc3)cc2n1Cc1ccccc1 |
| InChI | InChI=1S/C23H23N5O2/c1-26-22(29)20-8-7-18(13-21(20)28(26)16-17-5-3-2-4-6-17)19-14-24-23(25-15-19)27-9-11-30-12-10-27/h2-8,13-15H,9-12,16H2,1H3 |
| InChIKey | SDDDUMHHFOMSSI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 65.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |