C24H23N5O3 — CID 122621579
2-(5-spiro[11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-13,4'-2,3-dihydrochromene]-4-ylpyrimidin-2-yl)propan-2-ol (PubChem CID 122621579) has the molecular formula C24H23N5O3 and a molecular weight of 429.48 g/mol. Its IUPAC name is 2-(5-spiro[11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-13,4'-2,3-dihydrochromene]-4-ylpyrimidin-2-yl)propan-2-ol.
| Compound Name | 2-(5-spiro[11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-13,4'-2,3-dihydrochromene]-4-ylpyrimidin-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 122621579 |
| Molecular Formula | C24H23N5O3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 2-(5-spiro[11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-13,4'-2,3-dihydrochromene]-4-ylpyrimidin-2-yl)propan-2-ol |
| SMILES | CC(C)(O)c1ncc(-c2ccc3nc4n(c3n2)C2(CCOc3ccccc32)COC4)cn1 |
| InChI | InChI=1S/C24H23N5O3/c1-23(2,30)22-25-11-15(12-26-22)17-7-8-18-21(28-17)29-20(27-18)13-31-14-24(29)9-10-32-19-6-4-3-5-16(19)24/h3-8,11-12,30H,9-10,13-14H2,1-2H3 |
| InChIKey | KZINCZIVLLURGU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |