C15H11BrFN3O — CID 122621914
4-bromo-13-(2-fluorophenyl)-11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene (PubChem CID 122621914) has the molecular formula C15H11BrFN3O and a molecular weight of 348.18 g/mol. Its IUPAC name is 4-bromo-13-(2-fluorophenyl)-11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene.
| Compound Name | 4-bromo-13-(2-fluorophenyl)-11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene |
|---|---|
| PubChem CID | 122621914 |
| Molecular Formula | C15H11BrFN3O |
| Molecular Weight | 348.18 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 4-bromo-13-(2-fluorophenyl)-11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene |
| SMILES | Fc1ccccc1C1COCc2nc3ccc(Br)nc3n21 |
| InChI | InChI=1S/C15H11BrFN3O/c16-13-6-5-11-15(19-13)20-12(7-21-8-14(20)18-11)9-3-1-2-4-10(9)17/h1-6,12H,7-8H2 |
| InChIKey | NEPDIWCHXJQJJT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.18 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|