C16H14Br2N2O — CID 122622055
N-(2,4-dibromophenyl)-3-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine (PubChem CID 122622055) has the molecular formula C16H14Br2N2O and a molecular weight of 410.11 g/mol. Its IUPAC name is N-(2,4-dibromophenyl)-3-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine.
| Compound Name | N-(2,4-dibromophenyl)-3-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine |
|---|---|
| PubChem CID | 122622055 |
| Molecular Formula | C16H14Br2N2O |
| Molecular Weight | 410.11 g/mol |
| Exact Mass | 407.95 |
| IUPAC Name | N-(2,4-dibromophenyl)-3-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine |
| SMILES | Brc1ccc(NC2=NC(c3ccccc3)COC2)c(Br)c1 |
| InChI | InChI=1S/C16H14Br2N2O/c17-12-6-7-14(13(18)8-12)19-16-10-21-9-15(20-16)11-4-2-1-3-5-11/h1-8,15H,9-10H2,(H,19,20) |
| InChIKey | YHRXLWPZGLNTLA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.11 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |