C20H18F6N2O4S — CID 122622173
2-[4-(cyclopropylmethylsulfonyl)phenyl]-N-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-pyridinyl]acetamide (PubChem CID 122622173) has the molecular formula C20H18F6N2O4S and a molecular weight of 496.43 g/mol. Its IUPAC name is 2-[4-(cyclopropylmethylsulfonyl)phenyl]-N-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-pyridinyl]acetamide.
| Compound Name | 2-[4-(cyclopropylmethylsulfonyl)phenyl]-N-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 122622173 |
| Molecular Formula | C20H18F6N2O4S |
| Molecular Weight | 496.43 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 2-[4-(cyclopropylmethylsulfonyl)phenyl]-N-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-pyridinyl]acetamide |
| SMILES | O=C(Cc1ccc(S(=O)(=O)CC2CC2)cc1)Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C20H18F6N2O4S/c21-19(22,23)18(30,20(24,25)26)14-5-8-16(27-10-14)28-17(29)9-12-3-6-15(7-4-12)33(31,32)11-13-1-2-13/h3-8,10,13,30H,1-2,9,11H2,(H,27,28,29) |
| InChIKey | PXCJUROWBIGSTQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |