C23H22N6O2 — CID 122622233
12-(2-morpholin-4-ylpyrimidin-5-yl)-3-phenyl-4-oxa-1,8,13-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene (PubChem CID 122622233) has the molecular formula C23H22N6O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is 12-(2-morpholin-4-ylpyrimidin-5-yl)-3-phenyl-4-oxa-1,8,13-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene.
| Compound Name | 12-(2-morpholin-4-ylpyrimidin-5-yl)-3-phenyl-4-oxa-1,8,13-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
|---|---|
| PubChem CID | 122622233 |
| Molecular Formula | C23H22N6O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 12-(2-morpholin-4-ylpyrimidin-5-yl)-3-phenyl-4-oxa-1,8,13-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
| SMILES | c1ccc(C2OCCc3nc4ccc(-c5cnc(N6CCOCC6)nc5)nn4c32)cc1 |
| InChI | InChI=1S/C23H22N6O2/c1-2-4-16(5-3-1)22-21-19(8-11-31-22)26-20-7-6-18(27-29(20)21)17-14-24-23(25-15-17)28-9-12-30-13-10-28/h1-7,14-15,22H,8-13H2 |
| InChIKey | YCSIDXFUMICOAZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 77.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |