C27H26F2N4O — CID 122622548
1-[(4,4-difluorocyclohexyl)methyl]-4-[(3R)-3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]pyridin-2-one (PubChem CID 122622548) has the molecular formula C27H26F2N4O and a molecular weight of 460.53 g/mol. Its IUPAC name is 1-[(4,4-difluorocyclohexyl)methyl]-4-[(3R)-3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]pyridin-2-one.
| Compound Name | 1-[(4,4-difluorocyclohexyl)methyl]-4-[(3R)-3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]pyridin-2-one |
|---|---|
| PubChem CID | 122622548 |
| Molecular Formula | C27H26F2N4O |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 1-[(4,4-difluorocyclohexyl)methyl]-4-[(3R)-3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]pyridin-2-one |
| SMILES | O=c1cc(-c2ccc3nc4n(c3n2)[C@@H](c2ccccc2)CC4)ccn1CC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C27H26F2N4O/c28-27(29)13-10-18(11-14-27)17-32-15-12-20(16-25(32)34)21-6-7-22-26(31-21)33-23(8-9-24(33)30-22)19-4-2-1-3-5-19/h1-7,12,15-16,18,23H,8-11,13-14,17H2/t23-/m1/s1 |
| InChIKey | PINVHVPYOCEELA-HSZRJFAPSA-N |
| XLogP | 5.62 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |