C24H25N6O4P — CID 122622561
[1-[5-[(3R)-3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]pyrimidin-2-yl]piperidin-4-yl] dihydrogen phosphate (PubChem CID 122622561) has the molecular formula C24H25N6O4P and a molecular weight of 492.48 g/mol. Its IUPAC name is [1-[5-[(3R)-3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]pyrimidin-2-yl]piperidin-4-yl] dihydrogen phosphate.
| Compound Name | [1-[5-[(3R)-3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]pyrimidin-2-yl]piperidin-4-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 122622561 |
| Molecular Formula | C24H25N6O4P |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | [1-[5-[(3R)-3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]pyrimidin-2-yl]piperidin-4-yl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC1CCN(c2ncc(-c3ccc4nc5n(c4n3)[C@@H](c3ccccc3)CC5)cn2)CC1 |
| InChI | InChI=1S/C24H25N6O4P/c31-35(32,33)34-18-10-12-29(13-11-18)24-25-14-17(15-26-24)19-6-7-20-23(28-19)30-21(8-9-22(30)27-20)16-4-2-1-3-5-16/h1-7,14-15,18,21H,8-13H2,(H2,31,32,33)/t21-/m1/s1 |
| InChIKey | YLXCMGIHPZMPFG-OAQYLSRUSA-N |
| XLogP | 3.50 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|