C22H26N6O2 — CID 122622635
12-(2-morpholin-4-ylpyrimidin-5-yl)spiro[4-oxa-1,8,13-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene-3,1'-cyclohexane] (PubChem CID 122622635) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 12-(2-morpholin-4-ylpyrimidin-5-yl)spiro[4-oxa-1,8,13-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene-3,1'-cyclohexane].
| Compound Name | 12-(2-morpholin-4-ylpyrimidin-5-yl)spiro[4-oxa-1,8,13-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene-3,1'-cyclohexane] |
|---|---|
| PubChem CID | 122622635 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 12-(2-morpholin-4-ylpyrimidin-5-yl)spiro[4-oxa-1,8,13-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene-3,1'-cyclohexane] |
| SMILES | c1nc(N2CCOCC2)ncc1-c1ccc2nc3c(n2n1)C1(CCCCC1)OCC3 |
| InChI | InChI=1S/C22H26N6O2/c1-2-7-22(8-3-1)20-18(6-11-30-22)25-19-5-4-17(26-28(19)20)16-14-23-21(24-15-16)27-9-12-29-13-10-27/h4-5,14-15H,1-3,6-13H2 |
| InChIKey | BNZYSHGEOKCXIY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 77.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |