C18H22N2O4 — CID 122622976
(7S)-N-hydroxy-N-(oxetan-3-ylmethyl)-2'-oxospiro[6,8-dihydro-5H-naphthalene-7,4'-pyrrolidine]-2-carboxamide (PubChem CID 122622976) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is (7S)-N-hydroxy-N-(oxetan-3-ylmethyl)-2'-oxospiro[6,8-dihydro-5H-naphthalene-7,4'-pyrrolidine]-2-carboxamide.
| Compound Name | (7S)-N-hydroxy-N-(oxetan-3-ylmethyl)-2'-oxospiro[6,8-dihydro-5H-naphthalene-7,4'-pyrrolidine]-2-carboxamide |
|---|---|
| PubChem CID | 122622976 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (7S)-N-hydroxy-N-(oxetan-3-ylmethyl)-2'-oxospiro[6,8-dihydro-5H-naphthalene-7,4'-pyrrolidine]-2-carboxamide |
| SMILES | O=C1C[C@@]2(CCc3ccc(C(=O)N(O)CC4COC4)cc3C2)CN1 |
| InChI | InChI=1S/C18H22N2O4/c21-16-7-18(11-19-16)4-3-13-1-2-14(5-15(13)6-18)17(22)20(23)8-12-9-24-10-12/h1-2,5,12,23H,3-4,6-11H2,(H,19,21)/t18-/m0/s1 |
| InChIKey | PKISQXPUFVIMDG-SFHVURJKSA-N |
| XLogP | 1.16 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|