6-amino-3,5,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid

C7H6F3NO2 — CID 122623111

IUPAC6-amino-3,5,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid
SMILESNC1(F)C(F)=CC(F)=CC1C(=O)O
InChIInChI=1S/C7H6F3NO2/c8-3-1-4(6(12)13)7(10,11)5(9)2-3/h1-2,4H,11H2,(H,12,13)
InChIKeyFNBGVFHSJMVALA-UHFFFAOYSA-N
MW193.12 g/mol
LogP1.03
Rot. Bonds1

About 6-amino-3,5,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid

6-amino-3,5,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 122623111) has the molecular formula C7H6F3NO2 and a molecular weight of 193.12 g/mol. Its IUPAC name is 6-amino-3,5,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid.

Molecular Properties

Compound Name6-amino-3,5,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid
PubChem CID122623111
Molecular FormulaC7H6F3NO2
Molecular Weight193.12 g/mol
Exact Mass193.04
IUPAC Name6-amino-3,5,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid
SMILESNC1(F)C(F)=CC(F)=CC1C(=O)O
InChIInChI=1S/C7H6F3NO2/c8-3-1-4(6(12)13)7(10,11)5(9)2-3/h1-2,4H,11H2,(H,12,13)
InChIKeyFNBGVFHSJMVALA-UHFFFAOYSA-N
XLogP1.03
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.12
LogP ≤ 51.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze 6-amino-3,5,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-amino-3,5,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 6-amino-3,5,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid (CID 122623111) is 6-amino-3,5,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 6-amino-3,5,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 6-amino-3,5,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid is NC1(F)C(F)=CC(F)=CC1C(=O)O.
What is the InChIKey of 6-amino-3,5,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is FNBGVFHSJMVALA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3NO2/c8-3-1-4(6(12)13)7(10,11)5(9)2-3/h1-2,4H,11H2,(H,12,13).
What are the key properties of 6-amino-3,5,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid?
6-amino-3,5,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 193.12 g/mol, XLogP of 1.03, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3,5,6-trifluorocyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 122623111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).