C22H20FNO4 — CID 122623177
[3-(4-fluorophenyl)-4-(2-phenylmethoxyethoxy)phenyl] carbamate (PubChem CID 122623177) has the molecular formula C22H20FNO4 and a molecular weight of 381.40 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-4-(2-phenylmethoxyethoxy)phenyl] carbamate.
| Compound Name | [3-(4-fluorophenyl)-4-(2-phenylmethoxyethoxy)phenyl] carbamate |
|---|---|
| PubChem CID | 122623177 |
| Molecular Formula | C22H20FNO4 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | [3-(4-fluorophenyl)-4-(2-phenylmethoxyethoxy)phenyl] carbamate |
| SMILES | NC(=O)Oc1ccc(OCCOCc2ccccc2)c(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H20FNO4/c23-18-8-6-17(7-9-18)20-14-19(28-22(24)25)10-11-21(20)27-13-12-26-15-16-4-2-1-3-5-16/h1-11,14H,12-13,15H2,(H2,24,25) |
| InChIKey | CVJBHHANFIDSOR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|