About N-[7-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-phenyl-1-benzofuran-5-yl]methanesulfonamide
N-[7-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-phenyl-1-benzofuran-5-yl]methanesulfonamide (PubChem CID 122623722) has the molecular formula C22H20N2O4S
and a molecular weight of 408.48 g/mol. Its IUPAC name is N-[7-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-phenyl-1-benzofuran-5-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[7-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-phenyl-1-benzofuran-5-yl]methanesulfonamide |
| PubChem CID | 122623722 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | N-[7-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-phenyl-1-benzofuran-5-yl]methanesulfonamide |
| SMILES | Cc1cc(-c2cc(NS(C)(=O)=O)cc3cc(-c4ccccc4)oc23)cn(C)c1=O |
| InChI | InChI=1S/C22H20N2O4S/c1-14-9-17(13-24(2)22(14)25)19-12-18(23-29(3,26)27)10-16-11-20(28-21(16)19)15-7-5-4-6-8-15/h4-13,23H,1-3H3 |
| InChIKey | CWTBTGRGLZOOIY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[7-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-phenyl-1-benzofuran-5-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[7-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-phenyl-1-benzofuran-5-yl]methanesulfonamide?
The IUPAC name of N-[7-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-phenyl-1-benzofuran-5-yl]methanesulfonamide (CID 122623722) is N-[7-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-phenyl-1-benzofuran-5-yl]methanesulfonamide.
What is the SMILES notation for N-[7-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-phenyl-1-benzofuran-5-yl]methanesulfonamide?
The canonical SMILES for N-[7-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-phenyl-1-benzofuran-5-yl]methanesulfonamide is Cc1cc(-c2cc(NS(C)(=O)=O)cc3cc(-c4ccccc4)oc23)cn(C)c1=O.
What is the InChIKey of N-[7-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-phenyl-1-benzofuran-5-yl]methanesulfonamide?
The InChIKey is CWTBTGRGLZOOIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O4S/c1-14-9-17(13-24(2)22(14)25)19-12-18(23-29(3,26)27)10-16-11-20(28-21(16)19)15-7-5-4-6-8-15/h4-13,23H,1-3H3.
What are the key properties of N-[7-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-phenyl-1-benzofuran-5-yl]methanesulfonamide?
N-[7-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-phenyl-1-benzofuran-5-yl]methanesulfonamide has a molecular weight of 408.48 g/mol, XLogP of 4.15, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[7-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-phenyl-1-benzofuran-5-yl]methanesulfonamide is sourced from PubChem (CID 122623722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).