About 1-fluoro-6-methyl-2,3-dihydro-1H-indolizin-5-one
1-fluoro-6-methyl-2,3-dihydro-1H-indolizin-5-one (PubChem CID 122623743) has the molecular formula C9H10FNO
and a molecular weight of 167.18 g/mol. Its IUPAC name is 1-fluoro-6-methyl-2,3-dihydro-1H-indolizin-5-one.
Molecular Properties
| Compound Name | 1-fluoro-6-methyl-2,3-dihydro-1H-indolizin-5-one |
| PubChem CID | 122623743 |
| Molecular Formula | C9H10FNO |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 1-fluoro-6-methyl-2,3-dihydro-1H-indolizin-5-one |
| SMILES | Cc1ccc2n(c1=O)CCC2F |
| InChI | InChI=1S/C9H10FNO/c1-6-2-3-8-7(10)4-5-11(8)9(6)12/h2-3,7H,4-5H2,1H3 |
| InChIKey | FXRTYYRIVKSNKM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-fluoro-6-methyl-2,3-dihydro-1H-indolizin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-6-methyl-2,3-dihydro-1H-indolizin-5-one?
The IUPAC name of 1-fluoro-6-methyl-2,3-dihydro-1H-indolizin-5-one (CID 122623743) is 1-fluoro-6-methyl-2,3-dihydro-1H-indolizin-5-one.
What is the SMILES notation for 1-fluoro-6-methyl-2,3-dihydro-1H-indolizin-5-one?
The canonical SMILES for 1-fluoro-6-methyl-2,3-dihydro-1H-indolizin-5-one is Cc1ccc2n(c1=O)CCC2F.
What is the InChIKey of 1-fluoro-6-methyl-2,3-dihydro-1H-indolizin-5-one?
The InChIKey is FXRTYYRIVKSNKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNO/c1-6-2-3-8-7(10)4-5-11(8)9(6)12/h2-3,7H,4-5H2,1H3.
What are the key properties of 1-fluoro-6-methyl-2,3-dihydro-1H-indolizin-5-one?
1-fluoro-6-methyl-2,3-dihydro-1H-indolizin-5-one has a molecular weight of 167.18 g/mol, XLogP of 1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-6-methyl-2,3-dihydro-1H-indolizin-5-one is sourced from PubChem (CID 122623743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).