About ethyl (7S)-3-bromo-7-hydroxy-5,6-dihydrocyclopenta[b]pyridine-7-carboxylate
ethyl (7S)-3-bromo-7-hydroxy-5,6-dihydrocyclopenta[b]pyridine-7-carboxylate (PubChem CID 122623762) has the molecular formula C11H12BrNO3
and a molecular weight of 286.12 g/mol. Its IUPAC name is ethyl (7S)-3-bromo-7-hydroxy-5,6-dihydrocyclopenta[b]pyridine-7-carboxylate.
Molecular Properties
| Compound Name | ethyl (7S)-3-bromo-7-hydroxy-5,6-dihydrocyclopenta[b]pyridine-7-carboxylate |
| PubChem CID | 122623762 |
| Molecular Formula | C11H12BrNO3 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | ethyl (7S)-3-bromo-7-hydroxy-5,6-dihydrocyclopenta[b]pyridine-7-carboxylate |
| SMILES | CCOC(=O)[C@]1(O)CCc2cc(Br)cnc21 |
| InChI | InChI=1S/C11H12BrNO3/c1-2-16-10(14)11(15)4-3-7-5-8(12)6-13-9(7)11/h5-6,15H,2-4H2,1H3/t11-/m0/s1 |
| InChIKey | CVZRVZAALBWUAI-NSHDSACASA-N |
| XLogP | 1.54 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (7S)-3-bromo-7-hydroxy-5,6-dihydrocyclopenta[b]pyridine-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (7S)-3-bromo-7-hydroxy-5,6-dihydrocyclopenta[b]pyridine-7-carboxylate?
The IUPAC name of ethyl (7S)-3-bromo-7-hydroxy-5,6-dihydrocyclopenta[b]pyridine-7-carboxylate (CID 122623762) is ethyl (7S)-3-bromo-7-hydroxy-5,6-dihydrocyclopenta[b]pyridine-7-carboxylate.
What is the SMILES notation for ethyl (7S)-3-bromo-7-hydroxy-5,6-dihydrocyclopenta[b]pyridine-7-carboxylate?
The canonical SMILES for ethyl (7S)-3-bromo-7-hydroxy-5,6-dihydrocyclopenta[b]pyridine-7-carboxylate is CCOC(=O)[C@]1(O)CCc2cc(Br)cnc21.
What is the InChIKey of ethyl (7S)-3-bromo-7-hydroxy-5,6-dihydrocyclopenta[b]pyridine-7-carboxylate?
The InChIKey is CVZRVZAALBWUAI-NSHDSACASA-N. The full InChI is InChI=1S/C11H12BrNO3/c1-2-16-10(14)11(15)4-3-7-5-8(12)6-13-9(7)11/h5-6,15H,2-4H2,1H3/t11-/m0/s1.
What are the key properties of ethyl (7S)-3-bromo-7-hydroxy-5,6-dihydrocyclopenta[b]pyridine-7-carboxylate?
ethyl (7S)-3-bromo-7-hydroxy-5,6-dihydrocyclopenta[b]pyridine-7-carboxylate has a molecular weight of 286.12 g/mol, XLogP of 1.54, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (7S)-3-bromo-7-hydroxy-5,6-dihydrocyclopenta[b]pyridine-7-carboxylate is sourced from PubChem (CID 122623762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).