C23H16ClFN8O3 — CID 122623920
5-[2-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]-7-hydroxy-1-oxido-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-yl]-1H-imidazol-5-yl]-6-fluoro-1H-pyridin-2-one (PubChem CID 122623920) has the molecular formula C23H16ClFN8O3 and a molecular weight of 506.89 g/mol. Its IUPAC name is 5-[2-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]-7-hydroxy-1-oxido-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-yl]-1H-imidazol-5-yl]-6-fluoro-1H-pyridin-2-one.
| Compound Name | 5-[2-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]-7-hydroxy-1-oxido-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-yl]-1H-imidazol-5-yl]-6-fluoro-1H-pyridin-2-one |
|---|---|
| PubChem CID | 122623920 |
| Molecular Formula | C23H16ClFN8O3 |
| Molecular Weight | 506.89 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 5-[2-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]-7-hydroxy-1-oxido-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-yl]-1H-imidazol-5-yl]-6-fluoro-1H-pyridin-2-one |
| SMILES | O=c1ccc(-c2cnc(C3(O)CCc4cc(-c5cc(Cl)ccc5-n5cnnn5)c[n+]([O-])c43)[nH]2)c(F)[nH]1 |
| InChI | InChI=1S/C23H16ClFN8O3/c24-14-1-3-18(32-11-27-30-31-32)16(8-14)13-7-12-5-6-23(35,20(12)33(36)10-13)22-26-9-17(28-22)15-2-4-19(34)29-21(15)25/h1-4,7-11,35H,5-6H2,(H,26,28)(H,29,34) |
| InChIKey | FDXVSWCNMOUDCR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 152.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.89 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|