C23H25N3O3S3 — CID 122624329
2-[[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]methoxy]ethanol (PubChem CID 122624329) has the molecular formula C23H25N3O3S3 and a molecular weight of 487.67 g/mol. Its IUPAC name is 2-[[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]methoxy]ethanol.
| Compound Name | 2-[[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]methoxy]ethanol |
|---|---|
| PubChem CID | 122624329 |
| Molecular Formula | C23H25N3O3S3 |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | 2-[[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]methoxy]ethanol |
| SMILES | CCCCS(=O)c1sc2nc(-c3nccs3)cc(-c3ccc(COCCO)cc3)c2c1N |
| InChI | InChI=1S/C23H25N3O3S3/c1-2-3-12-32(28)23-20(24)19-17(16-6-4-15(5-7-16)14-29-10-9-27)13-18(26-22(19)31-23)21-25-8-11-30-21/h4-8,11,13,27H,2-3,9-10,12,14,24H2,1H3 |
| InChIKey | NPIUOWALTAEVCF-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|