C26H27N3O6S3 — CID 122624335
4-[2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]ethoxy]-4-oxobutanoic acid (PubChem CID 122624335) has the molecular formula C26H27N3O6S3 and a molecular weight of 573.72 g/mol. Its IUPAC name is 4-[2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]ethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 122624335 |
| Molecular Formula | C26H27N3O6S3 |
| Molecular Weight | 573.72 g/mol |
| Exact Mass | 573.11 |
| IUPAC Name | 4-[2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]ethoxy]-4-oxobutanoic acid |
| SMILES | CCCCS(=O)c1sc2nc(-c3nccs3)cc(-c3ccc(OCCOC(=O)CCC(=O)O)cc3)c2c1N |
| InChI | InChI=1S/C26H27N3O6S3/c1-2-3-14-38(33)26-23(27)22-18(15-19(29-25(22)37-26)24-28-10-13-36-24)16-4-6-17(7-5-16)34-11-12-35-21(32)9-8-20(30)31/h4-7,10,13,15H,2-3,8-9,11-12,14,27H2,1H3,(H,30,31) |
| InChIKey | CGPLPPVQMYLSEH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 141.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.72 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|