About 2-[4-[2-(1,3-thiazol-2-yl)propan-2-ylsulfonyl]phenyl]sulfanylpyrimidin-4-amine
2-[4-[2-(1,3-thiazol-2-yl)propan-2-ylsulfonyl]phenyl]sulfanylpyrimidin-4-amine (PubChem CID 122625327) has the molecular formula C16H16N4O2S3
and a molecular weight of 392.53 g/mol. Its IUPAC name is 2-[4-[2-(1,3-thiazol-2-yl)propan-2-ylsulfonyl]phenyl]sulfanylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-[4-[2-(1,3-thiazol-2-yl)propan-2-ylsulfonyl]phenyl]sulfanylpyrimidin-4-amine |
| PubChem CID | 122625327 |
| Molecular Formula | C16H16N4O2S3 |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 2-[4-[2-(1,3-thiazol-2-yl)propan-2-ylsulfonyl]phenyl]sulfanylpyrimidin-4-amine |
| SMILES | CC(C)(c1nccs1)S(=O)(=O)c1ccc(Sc2nccc(N)n2)cc1 |
| InChI | InChI=1S/C16H16N4O2S3/c1-16(2,14-18-9-10-23-14)25(21,22)12-5-3-11(4-6-12)24-15-19-8-7-13(17)20-15/h3-10H,1-2H3,(H2,17,19,20) |
| InChIKey | VTXVXNSFYLUTCC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[4-[2-(1,3-thiazol-2-yl)propan-2-ylsulfonyl]phenyl]sulfanylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(1,3-thiazol-2-yl)propan-2-ylsulfonyl]phenyl]sulfanylpyrimidin-4-amine?
The IUPAC name of 2-[4-[2-(1,3-thiazol-2-yl)propan-2-ylsulfonyl]phenyl]sulfanylpyrimidin-4-amine (CID 122625327) is 2-[4-[2-(1,3-thiazol-2-yl)propan-2-ylsulfonyl]phenyl]sulfanylpyrimidin-4-amine.
What is the SMILES notation for 2-[4-[2-(1,3-thiazol-2-yl)propan-2-ylsulfonyl]phenyl]sulfanylpyrimidin-4-amine?
The canonical SMILES for 2-[4-[2-(1,3-thiazol-2-yl)propan-2-ylsulfonyl]phenyl]sulfanylpyrimidin-4-amine is CC(C)(c1nccs1)S(=O)(=O)c1ccc(Sc2nccc(N)n2)cc1.
What is the InChIKey of 2-[4-[2-(1,3-thiazol-2-yl)propan-2-ylsulfonyl]phenyl]sulfanylpyrimidin-4-amine?
The InChIKey is VTXVXNSFYLUTCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O2S3/c1-16(2,14-18-9-10-23-14)25(21,22)12-5-3-11(4-6-12)24-15-19-8-7-13(17)20-15/h3-10H,1-2H3,(H2,17,19,20).
What are the key properties of 2-[4-[2-(1,3-thiazol-2-yl)propan-2-ylsulfonyl]phenyl]sulfanylpyrimidin-4-amine?
2-[4-[2-(1,3-thiazol-2-yl)propan-2-ylsulfonyl]phenyl]sulfanylpyrimidin-4-amine has a molecular weight of 392.53 g/mol, XLogP of 3.38, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(1,3-thiazol-2-yl)propan-2-ylsulfonyl]phenyl]sulfanylpyrimidin-4-amine is sourced from PubChem (CID 122625327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).