C25H25FN8O6S2 — CID 122625367
3-fluoro-4-[5-methoxy-4-[(5-methyl-1H-pyrazol-3-yl)amino]-6-morpholin-4-ylpyrimidin-2-yl]sulfanyl-N-(3-nitrophenyl)benzenesulfonamide (PubChem CID 122625367) has the molecular formula C25H25FN8O6S2 and a molecular weight of 616.66 g/mol. Its IUPAC name is 3-fluoro-4-[5-methoxy-4-[(5-methyl-1H-pyrazol-3-yl)amino]-6-morpholin-4-ylpyrimidin-2-yl]sulfanyl-N-(3-nitrophenyl)benzenesulfonamide.
| Compound Name | 3-fluoro-4-[5-methoxy-4-[(5-methyl-1H-pyrazol-3-yl)amino]-6-morpholin-4-ylpyrimidin-2-yl]sulfanyl-N-(3-nitrophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 122625367 |
| Molecular Formula | C25H25FN8O6S2 |
| Molecular Weight | 616.66 g/mol |
| Exact Mass | 616.13 |
| IUPAC Name | 3-fluoro-4-[5-methoxy-4-[(5-methyl-1H-pyrazol-3-yl)amino]-6-morpholin-4-ylpyrimidin-2-yl]sulfanyl-N-(3-nitrophenyl)benzenesulfonamide |
| SMILES | COc1c(Nc2cc(C)[nH]n2)nc(Sc2ccc(S(=O)(=O)Nc3cccc([N+](=O)[O-])c3)cc2F)nc1N1CCOCC1 |
| InChI | InChI=1S/C25H25FN8O6S2/c1-15-12-21(31-30-15)27-23-22(39-2)24(33-8-10-40-11-9-33)29-25(28-23)41-20-7-6-18(14-19(20)26)42(37,38)32-16-4-3-5-17(13-16)34(35)36/h3-7,12-14,32H,8-11H2,1-2H3,(H2,27,28,29,30,31) |
| InChIKey | CTCHPNLXNXGILH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 177.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.66 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|