C27H29F2N7O5S2 — CID 122625396
1-[2-[2-fluoro-4-[(2-fluoro-3-nitrophenyl)methylsulfonyl]phenyl]sulfanyl-5-methoxy-3-(5-methyl-1H-pyrazol-3-yl)-4H-pyrimidin-6-yl]piperidin-4-amine (PubChem CID 122625396) has the molecular formula C27H29F2N7O5S2 and a molecular weight of 633.70 g/mol. Its IUPAC name is 1-[2-[2-fluoro-4-[(2-fluoro-3-nitrophenyl)methylsulfonyl]phenyl]sulfanyl-5-methoxy-3-(5-methyl-1H-pyrazol-3-yl)-4H-pyrimidin-6-yl]piperidin-4-amine.
| Compound Name | 1-[2-[2-fluoro-4-[(2-fluoro-3-nitrophenyl)methylsulfonyl]phenyl]sulfanyl-5-methoxy-3-(5-methyl-1H-pyrazol-3-yl)-4H-pyrimidin-6-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 122625396 |
| Molecular Formula | C27H29F2N7O5S2 |
| Molecular Weight | 633.70 g/mol |
| Exact Mass | 633.16 |
| IUPAC Name | 1-[2-[2-fluoro-4-[(2-fluoro-3-nitrophenyl)methylsulfonyl]phenyl]sulfanyl-5-methoxy-3-(5-methyl-1H-pyrazol-3-yl)-4H-pyrimidin-6-yl]piperidin-4-amine |
| SMILES | COC1=C(N2CCC(N)CC2)N=C(Sc2ccc(S(=O)(=O)Cc3cccc([N+](=O)[O-])c3F)cc2F)N(c2cc(C)[nH]n2)C1 |
| InChI | InChI=1S/C27H29F2N7O5S2/c1-16-12-24(33-32-16)35-14-22(41-2)26(34-10-8-18(30)9-11-34)31-27(35)42-23-7-6-19(13-20(23)28)43(39,40)15-17-4-3-5-21(25(17)29)36(37)38/h3-7,12-13,18H,8-11,14-15,30H2,1-2H3,(H,32,33) |
| InChIKey | FCMYHELZRVLCPF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 160.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.70 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|