C6H15N3O2S — CID 122625851
(2S,4S)-4-methyl-2-[(sulfamoylamino)methyl]pyrrolidine (PubChem CID 122625851) has the molecular formula C6H15N3O2S and a molecular weight of 193.27 g/mol. Its IUPAC name is (2S,4S)-4-methyl-2-[(sulfamoylamino)methyl]pyrrolidine.
| Compound Name | (2S,4S)-4-methyl-2-[(sulfamoylamino)methyl]pyrrolidine |
|---|---|
| PubChem CID | 122625851 |
| Molecular Formula | C6H15N3O2S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (2S,4S)-4-methyl-2-[(sulfamoylamino)methyl]pyrrolidine |
| SMILES | C[C@@H]1CN[C@H](CNS(N)(=O)=O)C1 |
| InChI | InChI=1S/C6H15N3O2S/c1-5-2-6(8-3-5)4-9-12(7,10)11/h5-6,8-9H,2-4H2,1H3,(H2,7,10,11)/t5-,6-/m0/s1 |
| InChIKey | DPJDKFVRJQHISL-WDSKDSINSA-N |
| XLogP | -1.22 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |