About [2-[(4-ethyl-2,5-difluorophenoxy)methyl]-3-methylsulfanylphenyl] propanoate
[2-[(4-ethyl-2,5-difluorophenoxy)methyl]-3-methylsulfanylphenyl] propanoate (PubChem CID 122626890) has the molecular formula C19H20F2O3S
and a molecular weight of 366.43 g/mol. Its IUPAC name is [2-[(4-ethyl-2,5-difluorophenoxy)methyl]-3-methylsulfanylphenyl] propanoate.
Molecular Properties
| Compound Name | [2-[(4-ethyl-2,5-difluorophenoxy)methyl]-3-methylsulfanylphenyl] propanoate |
| PubChem CID | 122626890 |
| Molecular Formula | C19H20F2O3S |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | [2-[(4-ethyl-2,5-difluorophenoxy)methyl]-3-methylsulfanylphenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(SC)c1COc1cc(F)c(CC)cc1F |
| InChI | InChI=1S/C19H20F2O3S/c1-4-12-9-15(21)17(10-14(12)20)23-11-13-16(24-19(22)5-2)7-6-8-18(13)25-3/h6-10H,4-5,11H2,1-3H3 |
| InChIKey | XVSWCBABUKLHJQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[(4-ethyl-2,5-difluorophenoxy)methyl]-3-methylsulfanylphenyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-ethyl-2,5-difluorophenoxy)methyl]-3-methylsulfanylphenyl] propanoate?
The IUPAC name of [2-[(4-ethyl-2,5-difluorophenoxy)methyl]-3-methylsulfanylphenyl] propanoate (CID 122626890) is [2-[(4-ethyl-2,5-difluorophenoxy)methyl]-3-methylsulfanylphenyl] propanoate.
What is the SMILES notation for [2-[(4-ethyl-2,5-difluorophenoxy)methyl]-3-methylsulfanylphenyl] propanoate?
The canonical SMILES for [2-[(4-ethyl-2,5-difluorophenoxy)methyl]-3-methylsulfanylphenyl] propanoate is CCC(=O)Oc1cccc(SC)c1COc1cc(F)c(CC)cc1F.
What is the InChIKey of [2-[(4-ethyl-2,5-difluorophenoxy)methyl]-3-methylsulfanylphenyl] propanoate?
The InChIKey is XVSWCBABUKLHJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20F2O3S/c1-4-12-9-15(21)17(10-14(12)20)23-11-13-16(24-19(22)5-2)7-6-8-18(13)25-3/h6-10H,4-5,11H2,1-3H3.
What are the key properties of [2-[(4-ethyl-2,5-difluorophenoxy)methyl]-3-methylsulfanylphenyl] propanoate?
[2-[(4-ethyl-2,5-difluorophenoxy)methyl]-3-methylsulfanylphenyl] propanoate has a molecular weight of 366.43 g/mol, XLogP of 5.14, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-ethyl-2,5-difluorophenoxy)methyl]-3-methylsulfanylphenyl] propanoate is sourced from PubChem (CID 122626890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).