About 2-cyclohexa-2,4-dien-1-yl-4-iodopiperidin-3-ol
2-cyclohexa-2,4-dien-1-yl-4-iodopiperidin-3-ol (PubChem CID 122627027) has the molecular formula C11H16INO
and a molecular weight of 305.16 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-yl-4-iodopiperidin-3-ol.
Molecular Properties
| Compound Name | 2-cyclohexa-2,4-dien-1-yl-4-iodopiperidin-3-ol |
| PubChem CID | 122627027 |
| Molecular Formula | C11H16INO |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-yl-4-iodopiperidin-3-ol |
| SMILES | OC1C(I)CCNC1C1C=CC=CC1 |
| InChI | InChI=1S/C11H16INO/c12-9-6-7-13-10(11(9)14)8-4-2-1-3-5-8/h1-4,8-11,13-14H,5-7H2 |
| InChIKey | ZHYHXJYEBBBZNN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexa-2,4-dien-1-yl-4-iodopiperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-2,4-dien-1-yl-4-iodopiperidin-3-ol?
The IUPAC name of 2-cyclohexa-2,4-dien-1-yl-4-iodopiperidin-3-ol (CID 122627027) is 2-cyclohexa-2,4-dien-1-yl-4-iodopiperidin-3-ol.
What is the SMILES notation for 2-cyclohexa-2,4-dien-1-yl-4-iodopiperidin-3-ol?
The canonical SMILES for 2-cyclohexa-2,4-dien-1-yl-4-iodopiperidin-3-ol is OC1C(I)CCNC1C1C=CC=CC1.
What is the InChIKey of 2-cyclohexa-2,4-dien-1-yl-4-iodopiperidin-3-ol?
The InChIKey is ZHYHXJYEBBBZNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16INO/c12-9-6-7-13-10(11(9)14)8-4-2-1-3-5-8/h1-4,8-11,13-14H,5-7H2.
What are the key properties of 2-cyclohexa-2,4-dien-1-yl-4-iodopiperidin-3-ol?
2-cyclohexa-2,4-dien-1-yl-4-iodopiperidin-3-ol has a molecular weight of 305.16 g/mol, XLogP of 1.65, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-2,4-dien-1-yl-4-iodopiperidin-3-ol is sourced from PubChem (CID 122627027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).