C46H28N4 — CID 122627210
9-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[12H-indeno[1,2-a]carbazole-7,9'-fluorene] (PubChem CID 122627210) has the molecular formula C46H28N4 and a molecular weight of 636.76 g/mol. Its IUPAC name is 9-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[12H-indeno[1,2-a]carbazole-7,9'-fluorene].
| Compound Name | 9-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[12H-indeno[1,2-a]carbazole-7,9'-fluorene] |
|---|---|
| PubChem CID | 122627210 |
| Molecular Formula | C46H28N4 |
| Molecular Weight | 636.76 g/mol |
| Exact Mass | 636.23 |
| IUPAC Name | 9-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[12H-indeno[1,2-a]carbazole-7,9'-fluorene] |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)C3(c5ccccc5-c5ccccc53)c3ccc5c([nH]c6ccccc65)c3-4)n2)cc1 |
| InChI | InChI=1S/C46H28N4/c1-3-13-28(14-4-1)43-48-44(29-15-5-2-6-16-29)50-45(49-43)30-23-24-35-39(27-30)46(36-20-10-7-17-31(36)32-18-8-11-21-37(32)46)38-26-25-34-33-19-9-12-22-40(33)47-42(34)41(35)38/h1-27,47H |
| InChIKey | LKHGPFQJMILEQR-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.76 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |